About N-[5-(2,3-difluorophenyl)-1H-pyrazol-3-yl]-4-methylsulfonylbutanamide
N-[5-(2,3-difluorophenyl)-1H-pyrazol-3-yl]-4-methylsulfonylbutanamide (PubChem CID 71917918) has the molecular formula C14H15F2N3O3S
and a molecular weight of 343.36 g/mol. Its IUPAC name is N-[5-(2,3-difluorophenyl)-1H-pyrazol-3-yl]-4-methylsulfonylbutanamide.
Molecular Properties
| Compound Name | N-[5-(2,3-difluorophenyl)-1H-pyrazol-3-yl]-4-methylsulfonylbutanamide |
| PubChem CID | 71917918 |
| Molecular Formula | C14H15F2N3O3S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | N-[5-(2,3-difluorophenyl)-1H-pyrazol-3-yl]-4-methylsulfonylbutanamide |
| SMILES | CS(=O)(=O)CCCC(=O)Nc1cc(-c2cccc(F)c2F)[nH]n1 |
| InChI | InChI=1S/C14H15F2N3O3S/c1-23(21,22)7-3-6-13(20)17-12-8-11(18-19-12)9-4-2-5-10(15)14(9)16/h2,4-5,8H,3,6-7H2,1H3,(H2,17,18,19,20) |
| InChIKey | UXXCKWRQBCSYSK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[5-(2,3-difluorophenyl)-1H-pyrazol-3-yl]-4-methylsulfonylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(2,3-difluorophenyl)-1H-pyrazol-3-yl]-4-methylsulfonylbutanamide?
The IUPAC name of N-[5-(2,3-difluorophenyl)-1H-pyrazol-3-yl]-4-methylsulfonylbutanamide (CID 71917918) is N-[5-(2,3-difluorophenyl)-1H-pyrazol-3-yl]-4-methylsulfonylbutanamide.
What is the SMILES notation for N-[5-(2,3-difluorophenyl)-1H-pyrazol-3-yl]-4-methylsulfonylbutanamide?
The canonical SMILES for N-[5-(2,3-difluorophenyl)-1H-pyrazol-3-yl]-4-methylsulfonylbutanamide is CS(=O)(=O)CCCC(=O)Nc1cc(-c2cccc(F)c2F)[nH]n1.
What is the InChIKey of N-[5-(2,3-difluorophenyl)-1H-pyrazol-3-yl]-4-methylsulfonylbutanamide?
The InChIKey is UXXCKWRQBCSYSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F2N3O3S/c1-23(21,22)7-3-6-13(20)17-12-8-11(18-19-12)9-4-2-5-10(15)14(9)16/h2,4-5,8H,3,6-7H2,1H3,(H2,17,18,19,20).
What are the key properties of N-[5-(2,3-difluorophenyl)-1H-pyrazol-3-yl]-4-methylsulfonylbutanamide?
N-[5-(2,3-difluorophenyl)-1H-pyrazol-3-yl]-4-methylsulfonylbutanamide has a molecular weight of 343.36 g/mol, XLogP of 2.12, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(2,3-difluorophenyl)-1H-pyrazol-3-yl]-4-methylsulfonylbutanamide is sourced from PubChem (CID 71917918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).