C13H12F4N2O — CID 71919024
1-cyclopent-3-en-1-yl-3-[(2,3,5,6-tetrafluorophenyl)methyl]urea (PubChem CID 71919024) has the molecular formula C13H12F4N2O and a molecular weight of 288.24 g/mol. Its IUPAC name is 1-cyclopent-3-en-1-yl-3-[(2,3,5,6-tetrafluorophenyl)methyl]urea.
| Compound Name | 1-cyclopent-3-en-1-yl-3-[(2,3,5,6-tetrafluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 71919024 |
| Molecular Formula | C13H12F4N2O |
| Molecular Weight | 288.24 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1-cyclopent-3-en-1-yl-3-[(2,3,5,6-tetrafluorophenyl)methyl]urea |
| SMILES | O=C(NCc1c(F)c(F)cc(F)c1F)NC1CC=CC1 |
| InChI | InChI=1S/C13H12F4N2O/c14-9-5-10(15)12(17)8(11(9)16)6-18-13(20)19-7-3-1-2-4-7/h1-2,5,7H,3-4,6H2,(H2,18,19,20) |
| InChIKey | BRUOYTZVFMRKQX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.24 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|