About methyl (6R)-4-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-6-methylmorpholine-2-carboxylate
methyl (6R)-4-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-6-methylmorpholine-2-carboxylate (PubChem CID 71919347) has the molecular formula C16H20FNO3
and a molecular weight of 293.34 g/mol. Its IUPAC name is methyl (6R)-4-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-6-methylmorpholine-2-carboxylate.
Molecular Properties
| Compound Name | methyl (6R)-4-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-6-methylmorpholine-2-carboxylate |
| PubChem CID | 71919347 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | methyl (6R)-4-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-6-methylmorpholine-2-carboxylate |
| SMILES | COC(=O)C1CN(C2CCc3ccc(F)cc32)C[C@@H](C)O1 |
| InChI | InChI=1S/C16H20FNO3/c1-10-8-18(9-15(21-10)16(19)20-2)14-6-4-11-3-5-12(17)7-13(11)14/h3,5,7,10,14-15H,4,6,8-9H2,1-2H3/t10-,14?,15?/m1/s1 |
| InChIKey | VRKWBFFZBASOFO-SFNBMPIDSA-N |
| XLogP | 2.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (6R)-4-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-6-methylmorpholine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (6R)-4-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-6-methylmorpholine-2-carboxylate?
The IUPAC name of methyl (6R)-4-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-6-methylmorpholine-2-carboxylate (CID 71919347) is methyl (6R)-4-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-6-methylmorpholine-2-carboxylate.
What is the SMILES notation for methyl (6R)-4-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-6-methylmorpholine-2-carboxylate?
The canonical SMILES for methyl (6R)-4-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-6-methylmorpholine-2-carboxylate is COC(=O)C1CN(C2CCc3ccc(F)cc32)C[C@@H](C)O1.
What is the InChIKey of methyl (6R)-4-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-6-methylmorpholine-2-carboxylate?
The InChIKey is VRKWBFFZBASOFO-SFNBMPIDSA-N. The full InChI is InChI=1S/C16H20FNO3/c1-10-8-18(9-15(21-10)16(19)20-2)14-6-4-11-3-5-12(17)7-13(11)14/h3,5,7,10,14-15H,4,6,8-9H2,1-2H3/t10-,14?,15?/m1/s1.
What are the key properties of methyl (6R)-4-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-6-methylmorpholine-2-carboxylate?
methyl (6R)-4-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-6-methylmorpholine-2-carboxylate has a molecular weight of 293.34 g/mol, XLogP of 2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (6R)-4-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-6-methylmorpholine-2-carboxylate is sourced from PubChem (CID 71919347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).