C18H26FN3O2 — CID 71919535
[(2R)-1-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]-1-oxopentan-2-yl]urea (PubChem CID 71919535) has the molecular formula C18H26FN3O2 and a molecular weight of 335.42 g/mol. Its IUPAC name is [(2R)-1-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]-1-oxopentan-2-yl]urea.
| Compound Name | [(2R)-1-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]-1-oxopentan-2-yl]urea |
|---|---|
| PubChem CID | 71919535 |
| Molecular Formula | C18H26FN3O2 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | [(2R)-1-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]-1-oxopentan-2-yl]urea |
| SMILES | CCC[C@@H](NC(N)=O)C(=O)N1CCC(Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C18H26FN3O2/c1-2-4-16(21-18(20)24)17(23)22-9-7-13(8-10-22)11-14-5-3-6-15(19)12-14/h3,5-6,12-13,16H,2,4,7-11H2,1H3,(H3,20,21,24)/t16-/m1/s1 |
| InChIKey | NKAWKJCGWPUPPW-MRXNPFEDSA-N |
| XLogP | 2.44 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |