About 1-benzyl-3-(1-cyclopropylpiperidin-4-yl)-1-(2,2-difluoroethyl)urea
1-benzyl-3-(1-cyclopropylpiperidin-4-yl)-1-(2,2-difluoroethyl)urea (PubChem CID 71919617) has the molecular formula C18H25F2N3O
and a molecular weight of 337.41 g/mol. Its IUPAC name is 1-benzyl-3-(1-cyclopropylpiperidin-4-yl)-1-(2,2-difluoroethyl)urea.
Molecular Properties
| Compound Name | 1-benzyl-3-(1-cyclopropylpiperidin-4-yl)-1-(2,2-difluoroethyl)urea |
| PubChem CID | 71919617 |
| Molecular Formula | C18H25F2N3O |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 1-benzyl-3-(1-cyclopropylpiperidin-4-yl)-1-(2,2-difluoroethyl)urea |
| SMILES | O=C(NC1CCN(C2CC2)CC1)N(Cc1ccccc1)CC(F)F |
| InChI | InChI=1S/C18H25F2N3O/c19-17(20)13-23(12-14-4-2-1-3-5-14)18(24)21-15-8-10-22(11-9-15)16-6-7-16/h1-5,15-17H,6-13H2,(H,21,24) |
| InChIKey | UTWQZOUIQFWSTE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-3-(1-cyclopropylpiperidin-4-yl)-1-(2,2-difluoroethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-(1-cyclopropylpiperidin-4-yl)-1-(2,2-difluoroethyl)urea?
The IUPAC name of 1-benzyl-3-(1-cyclopropylpiperidin-4-yl)-1-(2,2-difluoroethyl)urea (CID 71919617) is 1-benzyl-3-(1-cyclopropylpiperidin-4-yl)-1-(2,2-difluoroethyl)urea.
What is the SMILES notation for 1-benzyl-3-(1-cyclopropylpiperidin-4-yl)-1-(2,2-difluoroethyl)urea?
The canonical SMILES for 1-benzyl-3-(1-cyclopropylpiperidin-4-yl)-1-(2,2-difluoroethyl)urea is O=C(NC1CCN(C2CC2)CC1)N(Cc1ccccc1)CC(F)F.
What is the InChIKey of 1-benzyl-3-(1-cyclopropylpiperidin-4-yl)-1-(2,2-difluoroethyl)urea?
The InChIKey is UTWQZOUIQFWSTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25F2N3O/c19-17(20)13-23(12-14-4-2-1-3-5-14)18(24)21-15-8-10-22(11-9-15)16-6-7-16/h1-5,15-17H,6-13H2,(H,21,24).
What are the key properties of 1-benzyl-3-(1-cyclopropylpiperidin-4-yl)-1-(2,2-difluoroethyl)urea?
1-benzyl-3-(1-cyclopropylpiperidin-4-yl)-1-(2,2-difluoroethyl)urea has a molecular weight of 337.41 g/mol, XLogP of 3.09, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-(1-cyclopropylpiperidin-4-yl)-1-(2,2-difluoroethyl)urea is sourced from PubChem (CID 71919617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).