About 4-methyl-5-(7-methyl-2,3-dihydro-1,4-benzoxazine-4-carbonyl)-1H-pyridin-2-one
4-methyl-5-(7-methyl-2,3-dihydro-1,4-benzoxazine-4-carbonyl)-1H-pyridin-2-one (PubChem CID 71919825) has the molecular formula C16H16N2O3
and a molecular weight of 284.32 g/mol. Its IUPAC name is 4-methyl-5-(7-methyl-2,3-dihydro-1,4-benzoxazine-4-carbonyl)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 4-methyl-5-(7-methyl-2,3-dihydro-1,4-benzoxazine-4-carbonyl)-1H-pyridin-2-one |
| PubChem CID | 71919825 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 4-methyl-5-(7-methyl-2,3-dihydro-1,4-benzoxazine-4-carbonyl)-1H-pyridin-2-one |
| SMILES | Cc1ccc2c(c1)OCCN2C(=O)c1c[nH]c(=O)cc1C |
| InChI | InChI=1S/C16H16N2O3/c1-10-3-4-13-14(7-10)21-6-5-18(13)16(20)12-9-17-15(19)8-11(12)2/h3-4,7-9H,5-6H2,1-2H3,(H,17,19) |
| InChIKey | HOCYDAZTGNKBKI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-5-(7-methyl-2,3-dihydro-1,4-benzoxazine-4-carbonyl)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-(7-methyl-2,3-dihydro-1,4-benzoxazine-4-carbonyl)-1H-pyridin-2-one?
The IUPAC name of 4-methyl-5-(7-methyl-2,3-dihydro-1,4-benzoxazine-4-carbonyl)-1H-pyridin-2-one (CID 71919825) is 4-methyl-5-(7-methyl-2,3-dihydro-1,4-benzoxazine-4-carbonyl)-1H-pyridin-2-one.
What is the SMILES notation for 4-methyl-5-(7-methyl-2,3-dihydro-1,4-benzoxazine-4-carbonyl)-1H-pyridin-2-one?
The canonical SMILES for 4-methyl-5-(7-methyl-2,3-dihydro-1,4-benzoxazine-4-carbonyl)-1H-pyridin-2-one is Cc1ccc2c(c1)OCCN2C(=O)c1c[nH]c(=O)cc1C.
What is the InChIKey of 4-methyl-5-(7-methyl-2,3-dihydro-1,4-benzoxazine-4-carbonyl)-1H-pyridin-2-one?
The InChIKey is HOCYDAZTGNKBKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O3/c1-10-3-4-13-14(7-10)21-6-5-18(13)16(20)12-9-17-15(19)8-11(12)2/h3-4,7-9H,5-6H2,1-2H3,(H,17,19).
What are the key properties of 4-methyl-5-(7-methyl-2,3-dihydro-1,4-benzoxazine-4-carbonyl)-1H-pyridin-2-one?
4-methyl-5-(7-methyl-2,3-dihydro-1,4-benzoxazine-4-carbonyl)-1H-pyridin-2-one has a molecular weight of 284.32 g/mol, XLogP of 2.03, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-(7-methyl-2,3-dihydro-1,4-benzoxazine-4-carbonyl)-1H-pyridin-2-one is sourced from PubChem (CID 71919825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).