About 5-(benzenesulfonyl)-N,N-dimethylthiophene-2-carboxamide
5-(benzenesulfonyl)-N,N-dimethylthiophene-2-carboxamide (PubChem CID 71920351) has the molecular formula C13H13NO3S2
and a molecular weight of 295.39 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-N,N-dimethylthiophene-2-carboxamide.
Molecular Properties
| Compound Name | 5-(benzenesulfonyl)-N,N-dimethylthiophene-2-carboxamide |
| PubChem CID | 71920351 |
| Molecular Formula | C13H13NO3S2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 5-(benzenesulfonyl)-N,N-dimethylthiophene-2-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(S(=O)(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C13H13NO3S2/c1-14(2)13(15)11-8-9-12(18-11)19(16,17)10-6-4-3-5-7-10/h3-9H,1-2H3 |
| InChIKey | JJKSZADSMVBNDN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(benzenesulfonyl)-N,N-dimethylthiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(benzenesulfonyl)-N,N-dimethylthiophene-2-carboxamide?
The IUPAC name of 5-(benzenesulfonyl)-N,N-dimethylthiophene-2-carboxamide (CID 71920351) is 5-(benzenesulfonyl)-N,N-dimethylthiophene-2-carboxamide.
What is the SMILES notation for 5-(benzenesulfonyl)-N,N-dimethylthiophene-2-carboxamide?
The canonical SMILES for 5-(benzenesulfonyl)-N,N-dimethylthiophene-2-carboxamide is CN(C)C(=O)c1ccc(S(=O)(=O)c2ccccc2)s1.
What is the InChIKey of 5-(benzenesulfonyl)-N,N-dimethylthiophene-2-carboxamide?
The InChIKey is JJKSZADSMVBNDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3S2/c1-14(2)13(15)11-8-9-12(18-11)19(16,17)10-6-4-3-5-7-10/h3-9H,1-2H3.
What are the key properties of 5-(benzenesulfonyl)-N,N-dimethylthiophene-2-carboxamide?
5-(benzenesulfonyl)-N,N-dimethylthiophene-2-carboxamide has a molecular weight of 295.39 g/mol, XLogP of 2.28, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(benzenesulfonyl)-N,N-dimethylthiophene-2-carboxamide is sourced from PubChem (CID 71920351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).