C20H26N6O4 — CID 7192037
ethyl 4-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]benzoate (PubChem CID 7192037) has the molecular formula C20H26N6O4 and a molecular weight of 414.47 g/mol. Its IUPAC name is ethyl 4-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]benzoate.
| Compound Name | ethyl 4-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 7192037 |
| Molecular Formula | C20H26N6O4 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | ethyl 4-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C20H26N6O4/c1-2-30-17(27)15-3-5-16(6-4-15)21-18-22-19(25-7-11-28-12-8-25)24-20(23-18)26-9-13-29-14-10-26/h3-6H,2,7-14H2,1H3,(H,21,22,23,24) |
| InChIKey | WILLSHKJQODKHO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 101.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |