C19H24N6O4 — CID 7192038
methyl 4-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]benzoate (PubChem CID 7192038) has the molecular formula C19H24N6O4 and a molecular weight of 400.44 g/mol. Its IUPAC name is methyl 4-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]benzoate.
| Compound Name | methyl 4-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 7192038 |
| Molecular Formula | C19H24N6O4 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | methyl 4-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C19H24N6O4/c1-27-16(26)14-2-4-15(5-3-14)20-17-21-18(24-6-10-28-11-7-24)23-19(22-17)25-8-12-29-13-9-25/h2-5H,6-13H2,1H3,(H,20,21,22,23) |
| InChIKey | MEKQXIPUIGCXPS-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 101.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |