About N-(2-benzyl-1,3-benzoxazol-6-yl)thiadiazole-5-carboxamide
N-(2-benzyl-1,3-benzoxazol-6-yl)thiadiazole-5-carboxamide (PubChem CID 71920645) has the molecular formula C17H12N4O2S
and a molecular weight of 336.38 g/mol. Its IUPAC name is N-(2-benzyl-1,3-benzoxazol-6-yl)thiadiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(2-benzyl-1,3-benzoxazol-6-yl)thiadiazole-5-carboxamide |
| PubChem CID | 71920645 |
| Molecular Formula | C17H12N4O2S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | N-(2-benzyl-1,3-benzoxazol-6-yl)thiadiazole-5-carboxamide |
| SMILES | O=C(Nc1ccc2nc(Cc3ccccc3)oc2c1)c1cnns1 |
| InChI | InChI=1S/C17H12N4O2S/c22-17(15-10-18-21-24-15)19-12-6-7-13-14(9-12)23-16(20-13)8-11-4-2-1-3-5-11/h1-7,9-10H,8H2,(H,19,22) |
| InChIKey | BCHPMPMDLYDXCJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(2-benzyl-1,3-benzoxazol-6-yl)thiadiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-benzyl-1,3-benzoxazol-6-yl)thiadiazole-5-carboxamide?
The IUPAC name of N-(2-benzyl-1,3-benzoxazol-6-yl)thiadiazole-5-carboxamide (CID 71920645) is N-(2-benzyl-1,3-benzoxazol-6-yl)thiadiazole-5-carboxamide.
What is the SMILES notation for N-(2-benzyl-1,3-benzoxazol-6-yl)thiadiazole-5-carboxamide?
The canonical SMILES for N-(2-benzyl-1,3-benzoxazol-6-yl)thiadiazole-5-carboxamide is O=C(Nc1ccc2nc(Cc3ccccc3)oc2c1)c1cnns1.
What is the InChIKey of N-(2-benzyl-1,3-benzoxazol-6-yl)thiadiazole-5-carboxamide?
The InChIKey is BCHPMPMDLYDXCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N4O2S/c22-17(15-10-18-21-24-15)19-12-6-7-13-14(9-12)23-16(20-13)8-11-4-2-1-3-5-11/h1-7,9-10H,8H2,(H,19,22).
What are the key properties of N-(2-benzyl-1,3-benzoxazol-6-yl)thiadiazole-5-carboxamide?
N-(2-benzyl-1,3-benzoxazol-6-yl)thiadiazole-5-carboxamide has a molecular weight of 336.38 g/mol, XLogP of 3.52, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-benzyl-1,3-benzoxazol-6-yl)thiadiazole-5-carboxamide is sourced from PubChem (CID 71920645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).