About 4-(1,3-benzoxazol-2-ylmethyl)thieno[3,2-b]pyridin-7-one
4-(1,3-benzoxazol-2-ylmethyl)thieno[3,2-b]pyridin-7-one (PubChem CID 71920684) has the molecular formula C15H10N2O2S
and a molecular weight of 282.32 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-ylmethyl)thieno[3,2-b]pyridin-7-one.
Molecular Properties
| Compound Name | 4-(1,3-benzoxazol-2-ylmethyl)thieno[3,2-b]pyridin-7-one |
| PubChem CID | 71920684 |
| Molecular Formula | C15H10N2O2S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 4-(1,3-benzoxazol-2-ylmethyl)thieno[3,2-b]pyridin-7-one |
| SMILES | O=c1ccn(Cc2nc3ccccc3o2)c2ccsc12 |
| InChI | InChI=1S/C15H10N2O2S/c18-12-5-7-17(11-6-8-20-15(11)12)9-14-16-10-3-1-2-4-13(10)19-14/h1-8H,9H2 |
| InChIKey | PNPFJTRWDLBKCF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1,3-benzoxazol-2-ylmethyl)thieno[3,2-b]pyridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzoxazol-2-ylmethyl)thieno[3,2-b]pyridin-7-one?
The IUPAC name of 4-(1,3-benzoxazol-2-ylmethyl)thieno[3,2-b]pyridin-7-one (CID 71920684) is 4-(1,3-benzoxazol-2-ylmethyl)thieno[3,2-b]pyridin-7-one.
What is the SMILES notation for 4-(1,3-benzoxazol-2-ylmethyl)thieno[3,2-b]pyridin-7-one?
The canonical SMILES for 4-(1,3-benzoxazol-2-ylmethyl)thieno[3,2-b]pyridin-7-one is O=c1ccn(Cc2nc3ccccc3o2)c2ccsc12.
What is the InChIKey of 4-(1,3-benzoxazol-2-ylmethyl)thieno[3,2-b]pyridin-7-one?
The InChIKey is PNPFJTRWDLBKCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O2S/c18-12-5-7-17(11-6-8-20-15(11)12)9-14-16-10-3-1-2-4-13(10)19-14/h1-8H,9H2.
What are the key properties of 4-(1,3-benzoxazol-2-ylmethyl)thieno[3,2-b]pyridin-7-one?
4-(1,3-benzoxazol-2-ylmethyl)thieno[3,2-b]pyridin-7-one has a molecular weight of 282.32 g/mol, XLogP of 3.25, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzoxazol-2-ylmethyl)thieno[3,2-b]pyridin-7-one is sourced from PubChem (CID 71920684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).