C13H17NO2S — CID 71920706
N-cyclohex-2-en-1-yl-2-methylsulfonylaniline (PubChem CID 71920706) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is N-cyclohex-2-en-1-yl-2-methylsulfonylaniline.
| Compound Name | N-cyclohex-2-en-1-yl-2-methylsulfonylaniline |
|---|---|
| PubChem CID | 71920706 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | N-cyclohex-2-en-1-yl-2-methylsulfonylaniline |
| SMILES | CS(=O)(=O)c1ccccc1NC1C=CCCC1 |
| InChI | InChI=1S/C13H17NO2S/c1-17(15,16)13-10-6-5-9-12(13)14-11-7-3-2-4-8-11/h3,5-7,9-11,14H,2,4,8H2,1H3 |
| InChIKey | JPOZSZBDQJJZCG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|