C18H22FN5O — CID 71921567
3-[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)amino]-1-(2-fluorophenyl)pyrrolidin-2-one (PubChem CID 71921567) has the molecular formula C18H22FN5O and a molecular weight of 343.41 g/mol. Its IUPAC name is 3-[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)amino]-1-(2-fluorophenyl)pyrrolidin-2-one.
| Compound Name | 3-[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)amino]-1-(2-fluorophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 71921567 |
| Molecular Formula | C18H22FN5O |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 3-[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)amino]-1-(2-fluorophenyl)pyrrolidin-2-one |
| SMILES | CCc1nc2n(n1)CCCC2NC1CCN(c2ccccc2F)C1=O |
| InChI | InChI=1S/C18H22FN5O/c1-2-16-21-17-13(7-5-10-24(17)22-16)20-14-9-11-23(18(14)25)15-8-4-3-6-12(15)19/h3-4,6,8,13-14,20H,2,5,7,9-11H2,1H3 |
| InChIKey | WGYVLEPHQHRUQP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |