About (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(4-phenylcyclohexyl)methanone
(2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(4-phenylcyclohexyl)methanone (PubChem CID 71921754) has the molecular formula C19H27NO2S
and a molecular weight of 333.50 g/mol. Its IUPAC name is (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(4-phenylcyclohexyl)methanone.
Molecular Properties
| Compound Name | (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(4-phenylcyclohexyl)methanone |
| PubChem CID | 71921754 |
| Molecular Formula | C19H27NO2S |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(4-phenylcyclohexyl)methanone |
| SMILES | CC1(C)CN(C(=O)C2CCC(c3ccccc3)CC2)CCS1=O |
| InChI | InChI=1S/C19H27NO2S/c1-19(2)14-20(12-13-23(19)22)18(21)17-10-8-16(9-11-17)15-6-4-3-5-7-15/h3-7,16-17H,8-14H2,1-2H3 |
| InChIKey | MKDTVWLFKQNATA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(4-phenylcyclohexyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(4-phenylcyclohexyl)methanone?
The IUPAC name of (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(4-phenylcyclohexyl)methanone (CID 71921754) is (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(4-phenylcyclohexyl)methanone.
What is the SMILES notation for (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(4-phenylcyclohexyl)methanone?
The canonical SMILES for (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(4-phenylcyclohexyl)methanone is CC1(C)CN(C(=O)C2CCC(c3ccccc3)CC2)CCS1=O.
What is the InChIKey of (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(4-phenylcyclohexyl)methanone?
The InChIKey is MKDTVWLFKQNATA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27NO2S/c1-19(2)14-20(12-13-23(19)22)18(21)17-10-8-16(9-11-17)15-6-4-3-5-7-15/h3-7,16-17H,8-14H2,1-2H3.
What are the key properties of (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(4-phenylcyclohexyl)methanone?
(2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(4-phenylcyclohexyl)methanone has a molecular weight of 333.50 g/mol, XLogP of 3.33, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl)-(4-phenylcyclohexyl)methanone is sourced from PubChem (CID 71921754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).