About N-(4-hydroxy-2,2-dimethylpentyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide
N-(4-hydroxy-2,2-dimethylpentyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 71922009) has the molecular formula C15H26F3NO2
and a molecular weight of 309.37 g/mol. Its IUPAC name is N-(4-hydroxy-2,2-dimethylpentyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | N-(4-hydroxy-2,2-dimethylpentyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
| PubChem CID | 71922009 |
| Molecular Formula | C15H26F3NO2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | N-(4-hydroxy-2,2-dimethylpentyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | CC(O)CC(C)(C)CNC(=O)C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C15H26F3NO2/c1-10(20)8-14(2,3)9-19-13(21)11-6-4-5-7-12(11)15(16,17)18/h10-12,20H,4-9H2,1-3H3,(H,19,21) |
| InChIKey | LZEMIJVIKNERCH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4-hydroxy-2,2-dimethylpentyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-hydroxy-2,2-dimethylpentyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide?
The IUPAC name of N-(4-hydroxy-2,2-dimethylpentyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide (CID 71922009) is N-(4-hydroxy-2,2-dimethylpentyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide.
What is the SMILES notation for N-(4-hydroxy-2,2-dimethylpentyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide?
The canonical SMILES for N-(4-hydroxy-2,2-dimethylpentyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide is CC(O)CC(C)(C)CNC(=O)C1CCCCC1C(F)(F)F.
What is the InChIKey of N-(4-hydroxy-2,2-dimethylpentyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide?
The InChIKey is LZEMIJVIKNERCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26F3NO2/c1-10(20)8-14(2,3)9-19-13(21)11-6-4-5-7-12(11)15(16,17)18/h10-12,20H,4-9H2,1-3H3,(H,19,21).
What are the key properties of N-(4-hydroxy-2,2-dimethylpentyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide?
N-(4-hydroxy-2,2-dimethylpentyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide has a molecular weight of 309.37 g/mol, XLogP of 3.27, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-hydroxy-2,2-dimethylpentyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide is sourced from PubChem (CID 71922009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).