About 4-chloro-2-[[2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl]amino]-N-ethylbenzamide
4-chloro-2-[[2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl]amino]-N-ethylbenzamide (PubChem CID 71922694) has the molecular formula C16H20ClN5O2
and a molecular weight of 349.82 g/mol. Its IUPAC name is 4-chloro-2-[[2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl]amino]-N-ethylbenzamide.
Molecular Properties
| Compound Name | 4-chloro-2-[[2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl]amino]-N-ethylbenzamide |
| PubChem CID | 71922694 |
| Molecular Formula | C16H20ClN5O2 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 4-chloro-2-[[2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl]amino]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccc(Cl)cc1NCC(=O)Nc1cc(C)nn1C |
| InChI | InChI=1S/C16H20ClN5O2/c1-4-18-16(24)12-6-5-11(17)8-13(12)19-9-15(23)20-14-7-10(2)21-22(14)3/h5-8,19H,4,9H2,1-3H3,(H,18,24)(H,20,23) |
| InChIKey | AOTRNYTUHHZAMO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-2-[[2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl]amino]-N-ethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-[[2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl]amino]-N-ethylbenzamide?
The IUPAC name of 4-chloro-2-[[2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl]amino]-N-ethylbenzamide (CID 71922694) is 4-chloro-2-[[2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl]amino]-N-ethylbenzamide.
What is the SMILES notation for 4-chloro-2-[[2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl]amino]-N-ethylbenzamide?
The canonical SMILES for 4-chloro-2-[[2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl]amino]-N-ethylbenzamide is CCNC(=O)c1ccc(Cl)cc1NCC(=O)Nc1cc(C)nn1C.
What is the InChIKey of 4-chloro-2-[[2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl]amino]-N-ethylbenzamide?
The InChIKey is AOTRNYTUHHZAMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20ClN5O2/c1-4-18-16(24)12-6-5-11(17)8-13(12)19-9-15(23)20-14-7-10(2)21-22(14)3/h5-8,19H,4,9H2,1-3H3,(H,18,24)(H,20,23).
What are the key properties of 4-chloro-2-[[2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl]amino]-N-ethylbenzamide?
4-chloro-2-[[2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl]amino]-N-ethylbenzamide has a molecular weight of 349.82 g/mol, XLogP of 2.18, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-[[2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl]amino]-N-ethylbenzamide is sourced from PubChem (CID 71922694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).