About 1-cyclobutyl-3-(2-methylsulfanylcyclopentyl)-1-(3,3,3-trifluoropropyl)urea
1-cyclobutyl-3-(2-methylsulfanylcyclopentyl)-1-(3,3,3-trifluoropropyl)urea (PubChem CID 71922875) has the molecular formula C14H23F3N2OS
and a molecular weight of 324.41 g/mol. Its IUPAC name is 1-cyclobutyl-3-(2-methylsulfanylcyclopentyl)-1-(3,3,3-trifluoropropyl)urea.
Molecular Properties
| Compound Name | 1-cyclobutyl-3-(2-methylsulfanylcyclopentyl)-1-(3,3,3-trifluoropropyl)urea |
| PubChem CID | 71922875 |
| Molecular Formula | C14H23F3N2OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-cyclobutyl-3-(2-methylsulfanylcyclopentyl)-1-(3,3,3-trifluoropropyl)urea |
| SMILES | CSC1CCCC1NC(=O)N(CCC(F)(F)F)C1CCC1 |
| InChI | InChI=1S/C14H23F3N2OS/c1-21-12-7-3-6-11(12)18-13(20)19(10-4-2-5-10)9-8-14(15,16)17/h10-12H,2-9H2,1H3,(H,18,20) |
| InChIKey | FDHACZBVQMFWSF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclobutyl-3-(2-methylsulfanylcyclopentyl)-1-(3,3,3-trifluoropropyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclobutyl-3-(2-methylsulfanylcyclopentyl)-1-(3,3,3-trifluoropropyl)urea?
The IUPAC name of 1-cyclobutyl-3-(2-methylsulfanylcyclopentyl)-1-(3,3,3-trifluoropropyl)urea (CID 71922875) is 1-cyclobutyl-3-(2-methylsulfanylcyclopentyl)-1-(3,3,3-trifluoropropyl)urea.
What is the SMILES notation for 1-cyclobutyl-3-(2-methylsulfanylcyclopentyl)-1-(3,3,3-trifluoropropyl)urea?
The canonical SMILES for 1-cyclobutyl-3-(2-methylsulfanylcyclopentyl)-1-(3,3,3-trifluoropropyl)urea is CSC1CCCC1NC(=O)N(CCC(F)(F)F)C1CCC1.
What is the InChIKey of 1-cyclobutyl-3-(2-methylsulfanylcyclopentyl)-1-(3,3,3-trifluoropropyl)urea?
The InChIKey is FDHACZBVQMFWSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23F3N2OS/c1-21-12-7-3-6-11(12)18-13(20)19(10-4-2-5-10)9-8-14(15,16)17/h10-12H,2-9H2,1H3,(H,18,20).
What are the key properties of 1-cyclobutyl-3-(2-methylsulfanylcyclopentyl)-1-(3,3,3-trifluoropropyl)urea?
1-cyclobutyl-3-(2-methylsulfanylcyclopentyl)-1-(3,3,3-trifluoropropyl)urea has a molecular weight of 324.41 g/mol, XLogP of 3.79, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclobutyl-3-(2-methylsulfanylcyclopentyl)-1-(3,3,3-trifluoropropyl)urea is sourced from PubChem (CID 71922875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).