About N-[3-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]propyl]acetamide
N-[3-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]propyl]acetamide (PubChem CID 71922955) has the molecular formula C13H16BrN3OS
and a molecular weight of 342.26 g/mol. Its IUPAC name is N-[3-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]propyl]acetamide.
Molecular Properties
| Compound Name | N-[3-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]propyl]acetamide |
| PubChem CID | 71922955 |
| Molecular Formula | C13H16BrN3OS |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | N-[3-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]propyl]acetamide |
| SMILES | CC(=O)NCCCSCc1cn2cc(Br)ccc2n1 |
| InChI | InChI=1S/C13H16BrN3OS/c1-10(18)15-5-2-6-19-9-12-8-17-7-11(14)3-4-13(17)16-12/h3-4,7-8H,2,5-6,9H2,1H3,(H,15,18) |
| InChIKey | AJBURHGOTWWIPN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]propyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]propyl]acetamide?
The IUPAC name of N-[3-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]propyl]acetamide (CID 71922955) is N-[3-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]propyl]acetamide.
What is the SMILES notation for N-[3-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]propyl]acetamide?
The canonical SMILES for N-[3-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]propyl]acetamide is CC(=O)NCCCSCc1cn2cc(Br)ccc2n1.
What is the InChIKey of N-[3-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]propyl]acetamide?
The InChIKey is AJBURHGOTWWIPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrN3OS/c1-10(18)15-5-2-6-19-9-12-8-17-7-11(14)3-4-13(17)16-12/h3-4,7-8H,2,5-6,9H2,1H3,(H,15,18).
What are the key properties of N-[3-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]propyl]acetamide?
N-[3-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]propyl]acetamide has a molecular weight of 342.26 g/mol, XLogP of 2.86, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]propyl]acetamide is sourced from PubChem (CID 71922955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).