C15H19N5O2 — CID 71923300
3-[2-[methyl-[(1-methylbenzimidazol-2-yl)methyl]amino]ethyl]imidazolidine-2,4-dione (PubChem CID 71923300) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 3-[2-[methyl-[(1-methylbenzimidazol-2-yl)methyl]amino]ethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-[methyl-[(1-methylbenzimidazol-2-yl)methyl]amino]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71923300 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 3-[2-[methyl-[(1-methylbenzimidazol-2-yl)methyl]amino]ethyl]imidazolidine-2,4-dione |
| SMILES | CN(CCN1C(=O)CNC1=O)Cc1nc2ccccc2n1C |
| InChI | InChI=1S/C15H19N5O2/c1-18(7-8-20-14(21)9-16-15(20)22)10-13-17-11-5-3-4-6-12(11)19(13)2/h3-6H,7-10H2,1-2H3,(H,16,22) |
| InChIKey | LIYVUWRBDWNIBR-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|