C13H17BrFN3O — CID 71923955
[1-[(4-bromo-3-fluorophenyl)methyl]piperidin-4-yl]urea (PubChem CID 71923955) has the molecular formula C13H17BrFN3O and a molecular weight of 330.20 g/mol. Its IUPAC name is [1-[(4-bromo-3-fluorophenyl)methyl]piperidin-4-yl]urea.
| Compound Name | [1-[(4-bromo-3-fluorophenyl)methyl]piperidin-4-yl]urea |
|---|---|
| PubChem CID | 71923955 |
| Molecular Formula | C13H17BrFN3O |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | [1-[(4-bromo-3-fluorophenyl)methyl]piperidin-4-yl]urea |
| SMILES | NC(=O)NC1CCN(Cc2ccc(Br)c(F)c2)CC1 |
| InChI | InChI=1S/C13H17BrFN3O/c14-11-2-1-9(7-12(11)15)8-18-5-3-10(4-6-18)17-13(16)19/h1-2,7,10H,3-6,8H2,(H3,16,17,19) |
| InChIKey | PBXSTHHHDMCVHD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |