About 3-chloro-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)pyridin-4-amine
3-chloro-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)pyridin-4-amine (PubChem CID 71924199) has the molecular formula C13H17ClN2O
and a molecular weight of 252.74 g/mol. Its IUPAC name is 3-chloro-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)pyridin-4-amine.
Molecular Properties
| Compound Name | 3-chloro-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)pyridin-4-amine |
| PubChem CID | 71924199 |
| Molecular Formula | C13H17ClN2O |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 3-chloro-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)pyridin-4-amine |
| SMILES | CC1(C)C(Nc2ccncc2Cl)C2CCOC21 |
| InChI | InChI=1S/C13H17ClN2O/c1-13(2)11(8-4-6-17-12(8)13)16-10-3-5-15-7-9(10)14/h3,5,7-8,11-12H,4,6H2,1-2H3,(H,15,16) |
| InChIKey | XKAWRWQSAQYDHK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)pyridin-4-amine?
The IUPAC name of 3-chloro-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)pyridin-4-amine (CID 71924199) is 3-chloro-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)pyridin-4-amine.
What is the SMILES notation for 3-chloro-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)pyridin-4-amine?
The canonical SMILES for 3-chloro-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)pyridin-4-amine is CC1(C)C(Nc2ccncc2Cl)C2CCOC21.
What is the InChIKey of 3-chloro-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)pyridin-4-amine?
The InChIKey is XKAWRWQSAQYDHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN2O/c1-13(2)11(8-4-6-17-12(8)13)16-10-3-5-15-7-9(10)14/h3,5,7-8,11-12H,4,6H2,1-2H3,(H,15,16).
What are the key properties of 3-chloro-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)pyridin-4-amine?
3-chloro-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)pyridin-4-amine has a molecular weight of 252.74 g/mol, XLogP of 2.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)pyridin-4-amine is sourced from PubChem (CID 71924199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).