About N-(thian-3-yl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboxamide
N-(thian-3-yl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboxamide (PubChem CID 71924343) has the molecular formula C13H22F3N3OS
and a molecular weight of 325.40 g/mol. Its IUPAC name is N-(thian-3-yl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboxamide.
Molecular Properties
| Compound Name | N-(thian-3-yl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboxamide |
| PubChem CID | 71924343 |
| Molecular Formula | C13H22F3N3OS |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-(thian-3-yl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboxamide |
| SMILES | CC(N1CCN(C(=O)NC2CCCSC2)CC1)C(F)(F)F |
| InChI | InChI=1S/C13H22F3N3OS/c1-10(13(14,15)16)18-4-6-19(7-5-18)12(20)17-11-3-2-8-21-9-11/h10-11H,2-9H2,1H3,(H,17,20) |
| InChIKey | YZSWLYNCECQURE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(thian-3-yl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(thian-3-yl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboxamide?
The IUPAC name of N-(thian-3-yl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboxamide (CID 71924343) is N-(thian-3-yl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboxamide.
What is the SMILES notation for N-(thian-3-yl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboxamide?
The canonical SMILES for N-(thian-3-yl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboxamide is CC(N1CCN(C(=O)NC2CCCSC2)CC1)C(F)(F)F.
What is the InChIKey of N-(thian-3-yl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboxamide?
The InChIKey is YZSWLYNCECQURE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22F3N3OS/c1-10(13(14,15)16)18-4-6-19(7-5-18)12(20)17-11-3-2-8-21-9-11/h10-11H,2-9H2,1H3,(H,17,20).
What are the key properties of N-(thian-3-yl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboxamide?
N-(thian-3-yl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboxamide has a molecular weight of 325.40 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(thian-3-yl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboxamide is sourced from PubChem (CID 71924343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).