About 3-[(5-propan-2-yl-1,3-oxazol-2-yl)methylsulfanyl]propane-1,2-diol
3-[(5-propan-2-yl-1,3-oxazol-2-yl)methylsulfanyl]propane-1,2-diol (PubChem CID 71924610) has the molecular formula C10H17NO3S
and a molecular weight of 231.32 g/mol. Its IUPAC name is 3-[(5-propan-2-yl-1,3-oxazol-2-yl)methylsulfanyl]propane-1,2-diol.
Molecular Properties
| Compound Name | 3-[(5-propan-2-yl-1,3-oxazol-2-yl)methylsulfanyl]propane-1,2-diol |
| PubChem CID | 71924610 |
| Molecular Formula | C10H17NO3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 3-[(5-propan-2-yl-1,3-oxazol-2-yl)methylsulfanyl]propane-1,2-diol |
| SMILES | CC(C)c1cnc(CSCC(O)CO)o1 |
| InChI | InChI=1S/C10H17NO3S/c1-7(2)9-3-11-10(14-9)6-15-5-8(13)4-12/h3,7-8,12-13H,4-6H2,1-2H3 |
| InChIKey | HCESARNYJVIYIT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(5-propan-2-yl-1,3-oxazol-2-yl)methylsulfanyl]propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-propan-2-yl-1,3-oxazol-2-yl)methylsulfanyl]propane-1,2-diol?
The IUPAC name of 3-[(5-propan-2-yl-1,3-oxazol-2-yl)methylsulfanyl]propane-1,2-diol (CID 71924610) is 3-[(5-propan-2-yl-1,3-oxazol-2-yl)methylsulfanyl]propane-1,2-diol.
What is the SMILES notation for 3-[(5-propan-2-yl-1,3-oxazol-2-yl)methylsulfanyl]propane-1,2-diol?
The canonical SMILES for 3-[(5-propan-2-yl-1,3-oxazol-2-yl)methylsulfanyl]propane-1,2-diol is CC(C)c1cnc(CSCC(O)CO)o1.
What is the InChIKey of 3-[(5-propan-2-yl-1,3-oxazol-2-yl)methylsulfanyl]propane-1,2-diol?
The InChIKey is HCESARNYJVIYIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3S/c1-7(2)9-3-11-10(14-9)6-15-5-8(13)4-12/h3,7-8,12-13H,4-6H2,1-2H3.
What are the key properties of 3-[(5-propan-2-yl-1,3-oxazol-2-yl)methylsulfanyl]propane-1,2-diol?
3-[(5-propan-2-yl-1,3-oxazol-2-yl)methylsulfanyl]propane-1,2-diol has a molecular weight of 231.32 g/mol, XLogP of 1.38, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-propan-2-yl-1,3-oxazol-2-yl)methylsulfanyl]propane-1,2-diol is sourced from PubChem (CID 71924610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).