C14H19N3O3S — CID 71925044
2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione (PubChem CID 71925044) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is 2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione.
| Compound Name | 2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione |
|---|---|
| PubChem CID | 71925044 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione |
| SMILES | COC(C)c1nc(CN2C(=O)C3CCCCN3C2=O)cs1 |
| InChI | InChI=1S/C14H19N3O3S/c1-9(20-2)12-15-10(8-21-12)7-17-13(18)11-5-3-4-6-16(11)14(17)19/h8-9,11H,3-7H2,1-2H3 |
| InChIKey | OQJTUBSHNAAESH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|