C19H26N2O3 — CID 71925205
7,7-dimethyl-3-(2,2,3,3-tetramethylazetidine-1-carbonyl)-6,8-dihydro-1H-quinoline-2,5-dione (PubChem CID 71925205) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 7,7-dimethyl-3-(2,2,3,3-tetramethylazetidine-1-carbonyl)-6,8-dihydro-1H-quinoline-2,5-dione.
| Compound Name | 7,7-dimethyl-3-(2,2,3,3-tetramethylazetidine-1-carbonyl)-6,8-dihydro-1H-quinoline-2,5-dione |
|---|---|
| PubChem CID | 71925205 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 7,7-dimethyl-3-(2,2,3,3-tetramethylazetidine-1-carbonyl)-6,8-dihydro-1H-quinoline-2,5-dione |
| SMILES | CC1(C)CC(=O)c2cc(C(=O)N3CC(C)(C)C3(C)C)c(=O)[nH]c2C1 |
| InChI | InChI=1S/C19H26N2O3/c1-17(2)8-13-11(14(22)9-17)7-12(15(23)20-13)16(24)21-10-18(3,4)19(21,5)6/h7H,8-10H2,1-6H3,(H,20,23) |
| InChIKey | LJDRTQOSIDCOKT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |