About 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)morpholine
4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)morpholine (PubChem CID 71925342) has the molecular formula C9H13N3OS
and a molecular weight of 211.29 g/mol. Its IUPAC name is 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)morpholine.
Molecular Properties
| Compound Name | 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)morpholine |
| PubChem CID | 71925342 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)morpholine |
| SMILES | C1CN(c2nc(C3CC3)ns2)CCO1 |
| InChI | InChI=1S/C9H13N3OS/c1-2-7(1)8-10-9(14-11-8)12-3-5-13-6-4-12/h7H,1-6H2 |
| InChIKey | ATMFATKLWSHPHI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)morpholine?
The IUPAC name of 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)morpholine (CID 71925342) is 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)morpholine.
What is the SMILES notation for 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)morpholine?
The canonical SMILES for 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)morpholine is C1CN(c2nc(C3CC3)ns2)CCO1.
What is the InChIKey of 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)morpholine?
The InChIKey is ATMFATKLWSHPHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3OS/c1-2-7(1)8-10-9(14-11-8)12-3-5-13-6-4-12/h7H,1-6H2.
What are the key properties of 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)morpholine?
4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)morpholine has a molecular weight of 211.29 g/mol, XLogP of 1.25, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)morpholine is sourced from PubChem (CID 71925342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).