About 2-azaspiro[5.6]dodecan-2-yl-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone
2-azaspiro[5.6]dodecan-2-yl-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone (PubChem CID 71926236) has the molecular formula C17H26N2O3
and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-azaspiro[5.6]dodecan-2-yl-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone.
Molecular Properties
| Compound Name | 2-azaspiro[5.6]dodecan-2-yl-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone |
| PubChem CID | 71926236 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 2-azaspiro[5.6]dodecan-2-yl-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone |
| SMILES | COCc1cc(C(=O)N2CCCC3(CCCCCC3)C2)no1 |
| InChI | InChI=1S/C17H26N2O3/c1-21-12-14-11-15(18-22-14)16(20)19-10-6-9-17(13-19)7-4-2-3-5-8-17/h11H,2-10,12-13H2,1H3 |
| InChIKey | FEWJDGIGVSATBQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-azaspiro[5.6]dodecan-2-yl-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azaspiro[5.6]dodecan-2-yl-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone?
The IUPAC name of 2-azaspiro[5.6]dodecan-2-yl-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone (CID 71926236) is 2-azaspiro[5.6]dodecan-2-yl-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone.
What is the SMILES notation for 2-azaspiro[5.6]dodecan-2-yl-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone?
The canonical SMILES for 2-azaspiro[5.6]dodecan-2-yl-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone is COCc1cc(C(=O)N2CCCC3(CCCCCC3)C2)no1.
What is the InChIKey of 2-azaspiro[5.6]dodecan-2-yl-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone?
The InChIKey is FEWJDGIGVSATBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O3/c1-21-12-14-11-15(18-22-14)16(20)19-10-6-9-17(13-19)7-4-2-3-5-8-17/h11H,2-10,12-13H2,1H3.
What are the key properties of 2-azaspiro[5.6]dodecan-2-yl-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone?
2-azaspiro[5.6]dodecan-2-yl-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone has a molecular weight of 306.41 g/mol, XLogP of 3.40, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azaspiro[5.6]dodecan-2-yl-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone is sourced from PubChem (CID 71926236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).