C17H27N5O2 — CID 71927218
5-[1-[2-(3,5-dimethylpyrazol-1-yl)ethyl]piperidin-3-yl]-3,5-dimethylimidazolidine-2,4-dione (PubChem CID 71927218) has the molecular formula C17H27N5O2 and a molecular weight of 333.44 g/mol. Its IUPAC name is 5-[1-[2-(3,5-dimethylpyrazol-1-yl)ethyl]piperidin-3-yl]-3,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 5-[1-[2-(3,5-dimethylpyrazol-1-yl)ethyl]piperidin-3-yl]-3,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71927218 |
| Molecular Formula | C17H27N5O2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 5-[1-[2-(3,5-dimethylpyrazol-1-yl)ethyl]piperidin-3-yl]-3,5-dimethylimidazolidine-2,4-dione |
| SMILES | Cc1cc(C)n(CCN2CCCC(C3(C)NC(=O)N(C)C3=O)C2)n1 |
| InChI | InChI=1S/C17H27N5O2/c1-12-10-13(2)22(19-12)9-8-21-7-5-6-14(11-21)17(3)15(23)20(4)16(24)18-17/h10,14H,5-9,11H2,1-4H3,(H,18,24) |
| InChIKey | QTVYBJAYKXJGDH-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|