C17H25FN2O2 — CID 71927531
1-[4-[(3-fluoro-4-methoxyphenyl)methylamino]-3-methylpiperidin-1-yl]propan-1-one (PubChem CID 71927531) has the molecular formula C17H25FN2O2 and a molecular weight of 308.40 g/mol. Its IUPAC name is 1-[4-[(3-fluoro-4-methoxyphenyl)methylamino]-3-methylpiperidin-1-yl]propan-1-one.
| Compound Name | 1-[4-[(3-fluoro-4-methoxyphenyl)methylamino]-3-methylpiperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 71927531 |
| Molecular Formula | C17H25FN2O2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 1-[4-[(3-fluoro-4-methoxyphenyl)methylamino]-3-methylpiperidin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCC(NCc2ccc(OC)c(F)c2)C(C)C1 |
| InChI | InChI=1S/C17H25FN2O2/c1-4-17(21)20-8-7-15(12(2)11-20)19-10-13-5-6-16(22-3)14(18)9-13/h5-6,9,12,15,19H,4,7-8,10-11H2,1-3H3 |
| InChIKey | JVJCOMDWEJHXAW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |