C16H25N5S — CID 71929157
N,N-diethyl-5-[(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ylmethylamino)methyl]-1,3-thiazol-2-amine (PubChem CID 71929157) has the molecular formula C16H25N5S and a molecular weight of 319.48 g/mol. Its IUPAC name is N,N-diethyl-5-[(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ylmethylamino)methyl]-1,3-thiazol-2-amine.
| Compound Name | N,N-diethyl-5-[(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ylmethylamino)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 71929157 |
| Molecular Formula | C16H25N5S |
| Molecular Weight | 319.48 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | N,N-diethyl-5-[(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ylmethylamino)methyl]-1,3-thiazol-2-amine |
| SMILES | CCN(CC)c1ncc(CNCC2CCCn3ccnc32)s1 |
| InChI | InChI=1S/C16H25N5S/c1-3-20(4-2)16-19-12-14(22-16)11-17-10-13-6-5-8-21-9-7-18-15(13)21/h7,9,12-13,17H,3-6,8,10-11H2,1-2H3 |
| InChIKey | PLRIYVJLADVNOJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |