C14H17F3N4S — CID 71929240
1-(5-methylthiophen-2-yl)-N-[[8-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]methanamine (PubChem CID 71929240) has the molecular formula C14H17F3N4S and a molecular weight of 330.38 g/mol. Its IUPAC name is 1-(5-methylthiophen-2-yl)-N-[[8-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]methanamine.
| Compound Name | 1-(5-methylthiophen-2-yl)-N-[[8-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]methanamine |
|---|---|
| PubChem CID | 71929240 |
| Molecular Formula | C14H17F3N4S |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 1-(5-methylthiophen-2-yl)-N-[[8-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]methanamine |
| SMILES | Cc1ccc(CNCc2nnc3n2CCCC3C(F)(F)F)s1 |
| InChI | InChI=1S/C14H17F3N4S/c1-9-4-5-10(22-9)7-18-8-12-19-20-13-11(14(15,16)17)3-2-6-21(12)13/h4-5,11,18H,2-3,6-8H2,1H3 |
| InChIKey | VPNUHYSZNNUYFT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |