C15H16F4N4 — CID 71929252
1-(4-fluorophenyl)-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]methanamine (PubChem CID 71929252) has the molecular formula C15H16F4N4 and a molecular weight of 328.31 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]methanamine.
| Compound Name | 1-(4-fluorophenyl)-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]methanamine |
|---|---|
| PubChem CID | 71929252 |
| Molecular Formula | C15H16F4N4 |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]methanamine |
| SMILES | Fc1ccc(CNCc2nnc3n2CC(C(F)(F)F)CC3)cc1 |
| InChI | InChI=1S/C15H16F4N4/c16-12-4-1-10(2-5-12)7-20-8-14-22-21-13-6-3-11(9-23(13)14)15(17,18)19/h1-2,4-5,11,20H,3,6-9H2 |
| InChIKey | IMRKCJWJSLGDFR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |