About (2-propyl-1,3-thiazol-5-yl)-pyrrolidin-1-ylmethanone
(2-propyl-1,3-thiazol-5-yl)-pyrrolidin-1-ylmethanone (PubChem CID 71929554) has the molecular formula C11H16N2OS
and a molecular weight of 224.33 g/mol. Its IUPAC name is (2-propyl-1,3-thiazol-5-yl)-pyrrolidin-1-ylmethanone.
Molecular Properties
| Compound Name | (2-propyl-1,3-thiazol-5-yl)-pyrrolidin-1-ylmethanone |
| PubChem CID | 71929554 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (2-propyl-1,3-thiazol-5-yl)-pyrrolidin-1-ylmethanone |
| SMILES | CCCc1ncc(C(=O)N2CCCC2)s1 |
| InChI | InChI=1S/C11H16N2OS/c1-2-5-10-12-8-9(15-10)11(14)13-6-3-4-7-13/h8H,2-7H2,1H3 |
| InChIKey | YXBZWQDNIRAMQF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-propyl-1,3-thiazol-5-yl)-pyrrolidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-propyl-1,3-thiazol-5-yl)-pyrrolidin-1-ylmethanone?
The IUPAC name of (2-propyl-1,3-thiazol-5-yl)-pyrrolidin-1-ylmethanone (CID 71929554) is (2-propyl-1,3-thiazol-5-yl)-pyrrolidin-1-ylmethanone.
What is the SMILES notation for (2-propyl-1,3-thiazol-5-yl)-pyrrolidin-1-ylmethanone?
The canonical SMILES for (2-propyl-1,3-thiazol-5-yl)-pyrrolidin-1-ylmethanone is CCCc1ncc(C(=O)N2CCCC2)s1.
What is the InChIKey of (2-propyl-1,3-thiazol-5-yl)-pyrrolidin-1-ylmethanone?
The InChIKey is YXBZWQDNIRAMQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2OS/c1-2-5-10-12-8-9(15-10)11(14)13-6-3-4-7-13/h8H,2-7H2,1H3.
What are the key properties of (2-propyl-1,3-thiazol-5-yl)-pyrrolidin-1-ylmethanone?
(2-propyl-1,3-thiazol-5-yl)-pyrrolidin-1-ylmethanone has a molecular weight of 224.33 g/mol, XLogP of 2.33, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-propyl-1,3-thiazol-5-yl)-pyrrolidin-1-ylmethanone is sourced from PubChem (CID 71929554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).