C13H21NO2 — CID 71929593
2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl(oxolan-2-yl)methanone (PubChem CID 71929593) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl(oxolan-2-yl)methanone.
| Compound Name | 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 71929593 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl(oxolan-2-yl)methanone |
| SMILES | O=C(C1CCCO1)N1CCCC2CCCC21 |
| InChI | InChI=1S/C13H21NO2/c15-13(12-7-3-9-16-12)14-8-2-5-10-4-1-6-11(10)14/h10-12H,1-9H2 |
| InChIKey | NWNQYUGWOHSSQB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |