C19H30N2O2 — CID 71929793
N-(2-cyclohexylcyclopropyl)-1-(cyclopropanecarbonyl)piperidine-3-carboxamide (PubChem CID 71929793) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is N-(2-cyclohexylcyclopropyl)-1-(cyclopropanecarbonyl)piperidine-3-carboxamide.
| Compound Name | N-(2-cyclohexylcyclopropyl)-1-(cyclopropanecarbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 71929793 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | N-(2-cyclohexylcyclopropyl)-1-(cyclopropanecarbonyl)piperidine-3-carboxamide |
| SMILES | O=C(NC1CC1C1CCCCC1)C1CCCN(C(=O)C2CC2)C1 |
| InChI | InChI=1S/C19H30N2O2/c22-18(20-17-11-16(17)13-5-2-1-3-6-13)15-7-4-10-21(12-15)19(23)14-8-9-14/h13-17H,1-12H2,(H,20,22) |
| InChIKey | AKIIRLZYVMWKHB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |