About 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-pentan-2-ylpropanamide
3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-pentan-2-ylpropanamide (PubChem CID 71929870) has the molecular formula C17H23FN2O2
and a molecular weight of 306.38 g/mol. Its IUPAC name is 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-pentan-2-ylpropanamide.
Molecular Properties
| Compound Name | 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-pentan-2-ylpropanamide |
| PubChem CID | 71929870 |
| Molecular Formula | C17H23FN2O2 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-pentan-2-ylpropanamide |
| SMILES | CCCC(C)NC(=O)CCN1C(=O)CCc2cc(F)ccc21 |
| InChI | InChI=1S/C17H23FN2O2/c1-3-4-12(2)19-16(21)9-10-20-15-7-6-14(18)11-13(15)5-8-17(20)22/h6-7,11-12H,3-5,8-10H2,1-2H3,(H,19,21) |
| InChIKey | DTRIRKDLAXCRDC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-pentan-2-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-pentan-2-ylpropanamide?
The IUPAC name of 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-pentan-2-ylpropanamide (CID 71929870) is 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-pentan-2-ylpropanamide.
What is the SMILES notation for 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-pentan-2-ylpropanamide?
The canonical SMILES for 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-pentan-2-ylpropanamide is CCCC(C)NC(=O)CCN1C(=O)CCc2cc(F)ccc21.
What is the InChIKey of 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-pentan-2-ylpropanamide?
The InChIKey is DTRIRKDLAXCRDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23FN2O2/c1-3-4-12(2)19-16(21)9-10-20-15-7-6-14(18)11-13(15)5-8-17(20)22/h6-7,11-12H,3-5,8-10H2,1-2H3,(H,19,21).
What are the key properties of 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-pentan-2-ylpropanamide?
3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-pentan-2-ylpropanamide has a molecular weight of 306.38 g/mol, XLogP of 2.80, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-fluoro-2-oxo-3,4-dihydroquinolin-1-yl)-N-pentan-2-ylpropanamide is sourced from PubChem (CID 71929870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).