C12H16BrN3O2S — CID 71930296
1-[2-(5-bromothiophen-2-yl)ethyl]-3-(1-methyl-2-oxopyrrolidin-3-yl)urea (PubChem CID 71930296) has the molecular formula C12H16BrN3O2S and a molecular weight of 346.25 g/mol. Its IUPAC name is 1-[2-(5-bromothiophen-2-yl)ethyl]-3-(1-methyl-2-oxopyrrolidin-3-yl)urea.
| Compound Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-3-(1-methyl-2-oxopyrrolidin-3-yl)urea |
|---|---|
| PubChem CID | 71930296 |
| Molecular Formula | C12H16BrN3O2S |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-3-(1-methyl-2-oxopyrrolidin-3-yl)urea |
| SMILES | CN1CCC(NC(=O)NCCc2ccc(Br)s2)C1=O |
| InChI | InChI=1S/C12H16BrN3O2S/c1-16-7-5-9(11(16)17)15-12(18)14-6-4-8-2-3-10(13)19-8/h2-3,9H,4-7H2,1H3,(H2,14,15,18) |
| InChIKey | JMNHHPJLKFOJBF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |