C13H18N2O2 — CID 71930519
(2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-(1,2-oxazol-3-yl)methanone (PubChem CID 71930519) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is (2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-(1,2-oxazol-3-yl)methanone.
| Compound Name | (2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-(1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 71930519 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-(1,2-oxazol-3-yl)methanone |
| SMILES | CC1CC2CCCCC2N1C(=O)c1ccon1 |
| InChI | InChI=1S/C13H18N2O2/c1-9-8-10-4-2-3-5-12(10)15(9)13(16)11-6-7-17-14-11/h6-7,9-10,12H,2-5,8H2,1H3 |
| InChIKey | ZCAVDMUAONDKEQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |