About (1-benzylimidazol-2-yl)methyl 2-(pyridin-2-ylamino)-1,3-thiazole-4-carboxylate
(1-benzylimidazol-2-yl)methyl 2-(pyridin-2-ylamino)-1,3-thiazole-4-carboxylate (PubChem CID 71930613) has the molecular formula C20H17N5O2S
and a molecular weight of 391.46 g/mol. Its IUPAC name is (1-benzylimidazol-2-yl)methyl 2-(pyridin-2-ylamino)-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | (1-benzylimidazol-2-yl)methyl 2-(pyridin-2-ylamino)-1,3-thiazole-4-carboxylate |
| PubChem CID | 71930613 |
| Molecular Formula | C20H17N5O2S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (1-benzylimidazol-2-yl)methyl 2-(pyridin-2-ylamino)-1,3-thiazole-4-carboxylate |
| SMILES | O=C(OCc1nccn1Cc1ccccc1)c1csc(Nc2ccccn2)n1 |
| InChI | InChI=1S/C20H17N5O2S/c26-19(16-14-28-20(23-16)24-17-8-4-5-9-21-17)27-13-18-22-10-11-25(18)12-15-6-2-1-3-7-15/h1-11,14H,12-13H2,(H,21,23,24) |
| InChIKey | SOSJGHMWQZOBBE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (1-benzylimidazol-2-yl)methyl 2-(pyridin-2-ylamino)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-benzylimidazol-2-yl)methyl 2-(pyridin-2-ylamino)-1,3-thiazole-4-carboxylate?
The IUPAC name of (1-benzylimidazol-2-yl)methyl 2-(pyridin-2-ylamino)-1,3-thiazole-4-carboxylate (CID 71930613) is (1-benzylimidazol-2-yl)methyl 2-(pyridin-2-ylamino)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for (1-benzylimidazol-2-yl)methyl 2-(pyridin-2-ylamino)-1,3-thiazole-4-carboxylate?
The canonical SMILES for (1-benzylimidazol-2-yl)methyl 2-(pyridin-2-ylamino)-1,3-thiazole-4-carboxylate is O=C(OCc1nccn1Cc1ccccc1)c1csc(Nc2ccccn2)n1.
What is the InChIKey of (1-benzylimidazol-2-yl)methyl 2-(pyridin-2-ylamino)-1,3-thiazole-4-carboxylate?
The InChIKey is SOSJGHMWQZOBBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N5O2S/c26-19(16-14-28-20(23-16)24-17-8-4-5-9-21-17)27-13-18-22-10-11-25(18)12-15-6-2-1-3-7-15/h1-11,14H,12-13H2,(H,21,23,24).
What are the key properties of (1-benzylimidazol-2-yl)methyl 2-(pyridin-2-ylamino)-1,3-thiazole-4-carboxylate?
(1-benzylimidazol-2-yl)methyl 2-(pyridin-2-ylamino)-1,3-thiazole-4-carboxylate has a molecular weight of 391.46 g/mol, XLogP of 3.88, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (1-benzylimidazol-2-yl)methyl 2-(pyridin-2-ylamino)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 71930613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).