C16H22N2O2 — CID 71930780
2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(2-ethoxy-4-pyridinyl)methanone (PubChem CID 71930780) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(2-ethoxy-4-pyridinyl)methanone.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(2-ethoxy-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 71930780 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(2-ethoxy-4-pyridinyl)methanone |
| SMILES | CCOc1cc(C(=O)N2CCC3CCCCC32)ccn1 |
| InChI | InChI=1S/C16H22N2O2/c1-2-20-15-11-13(7-9-17-15)16(19)18-10-8-12-5-3-4-6-14(12)18/h7,9,11-12,14H,2-6,8,10H2,1H3 |
| InChIKey | MODJOYCZGOFGNM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |