About 5-cyclopropyl-N-[1-(1,3-thiazol-2-yl)cyclopentyl]-1,2-oxazole-3-carboxamide
5-cyclopropyl-N-[1-(1,3-thiazol-2-yl)cyclopentyl]-1,2-oxazole-3-carboxamide (PubChem CID 71930966) has the molecular formula C15H17N3O2S
and a molecular weight of 303.39 g/mol. Its IUPAC name is 5-cyclopropyl-N-[1-(1,3-thiazol-2-yl)cyclopentyl]-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-cyclopropyl-N-[1-(1,3-thiazol-2-yl)cyclopentyl]-1,2-oxazole-3-carboxamide |
| PubChem CID | 71930966 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 5-cyclopropyl-N-[1-(1,3-thiazol-2-yl)cyclopentyl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NC1(c2nccs2)CCCC1)c1cc(C2CC2)on1 |
| InChI | InChI=1S/C15H17N3O2S/c19-13(11-9-12(20-18-11)10-3-4-10)17-15(5-1-2-6-15)14-16-7-8-21-14/h7-10H,1-6H2,(H,17,19) |
| InChIKey | UTJBYFIVENHIIV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-cyclopropyl-N-[1-(1,3-thiazol-2-yl)cyclopentyl]-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-N-[1-(1,3-thiazol-2-yl)cyclopentyl]-1,2-oxazole-3-carboxamide?
The IUPAC name of 5-cyclopropyl-N-[1-(1,3-thiazol-2-yl)cyclopentyl]-1,2-oxazole-3-carboxamide (CID 71930966) is 5-cyclopropyl-N-[1-(1,3-thiazol-2-yl)cyclopentyl]-1,2-oxazole-3-carboxamide.
What is the SMILES notation for 5-cyclopropyl-N-[1-(1,3-thiazol-2-yl)cyclopentyl]-1,2-oxazole-3-carboxamide?
The canonical SMILES for 5-cyclopropyl-N-[1-(1,3-thiazol-2-yl)cyclopentyl]-1,2-oxazole-3-carboxamide is O=C(NC1(c2nccs2)CCCC1)c1cc(C2CC2)on1.
What is the InChIKey of 5-cyclopropyl-N-[1-(1,3-thiazol-2-yl)cyclopentyl]-1,2-oxazole-3-carboxamide?
The InChIKey is UTJBYFIVENHIIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O2S/c19-13(11-9-12(20-18-11)10-3-4-10)17-15(5-1-2-6-15)14-16-7-8-21-14/h7-10H,1-6H2,(H,17,19).
What are the key properties of 5-cyclopropyl-N-[1-(1,3-thiazol-2-yl)cyclopentyl]-1,2-oxazole-3-carboxamide?
5-cyclopropyl-N-[1-(1,3-thiazol-2-yl)cyclopentyl]-1,2-oxazole-3-carboxamide has a molecular weight of 303.39 g/mol, XLogP of 3.21, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-N-[1-(1,3-thiazol-2-yl)cyclopentyl]-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 71930966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).