About 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]propanoic acid;hydrochloride
2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]propanoic acid;hydrochloride (PubChem CID 71930967) has the molecular formula C16H22ClN3O2
and a molecular weight of 323.82 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]propanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]propanoic acid;hydrochloride |
| PubChem CID | 71930967 |
| Molecular Formula | C16H22ClN3O2 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]propanoic acid;hydrochloride |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CN(C)C(C)C(=O)O.Cl |
| InChI | InChI=1S/C16H21N3O2.ClH/c1-11-15(10-18(4)13(3)16(20)21)12(2)19(17-11)14-8-6-5-7-9-14;/h5-9,13H,10H2,1-4H3,(H,20,21);1H |
| InChIKey | VFHHKERSQPTPJP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]propanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]propanoic acid;hydrochloride?
The IUPAC name of 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]propanoic acid;hydrochloride (CID 71930967) is 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]propanoic acid;hydrochloride.
What is the SMILES notation for 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]propanoic acid;hydrochloride?
The canonical SMILES for 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]propanoic acid;hydrochloride is Cc1nn(-c2ccccc2)c(C)c1CN(C)C(C)C(=O)O.Cl.
What is the InChIKey of 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]propanoic acid;hydrochloride?
The InChIKey is VFHHKERSQPTPJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O2.ClH/c1-11-15(10-18(4)13(3)16(20)21)12(2)19(17-11)14-8-6-5-7-9-14;/h5-9,13H,10H2,1-4H3,(H,20,21);1H.
What are the key properties of 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]propanoic acid;hydrochloride?
2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]propanoic acid;hydrochloride has a molecular weight of 323.82 g/mol, XLogP of 2.82, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]propanoic acid;hydrochloride is sourced from PubChem (CID 71930967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).