About (1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(oxan-3-yl)methanone
(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(oxan-3-yl)methanone (PubChem CID 71931183) has the molecular formula C17H23NO2
and a molecular weight of 273.38 g/mol. Its IUPAC name is (1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(oxan-3-yl)methanone.
Molecular Properties
| Compound Name | (1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(oxan-3-yl)methanone |
| PubChem CID | 71931183 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(oxan-3-yl)methanone |
| SMILES | CCC1c2ccccc2CCN1C(=O)C1CCCOC1 |
| InChI | InChI=1S/C17H23NO2/c1-2-16-15-8-4-3-6-13(15)9-10-18(16)17(19)14-7-5-11-20-12-14/h3-4,6,8,14,16H,2,5,7,9-12H2,1H3 |
| InChIKey | HDQTXYSCWVXPKO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(oxan-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(oxan-3-yl)methanone?
The IUPAC name of (1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(oxan-3-yl)methanone (CID 71931183) is (1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(oxan-3-yl)methanone.
What is the SMILES notation for (1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(oxan-3-yl)methanone?
The canonical SMILES for (1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(oxan-3-yl)methanone is CCC1c2ccccc2CCN1C(=O)C1CCCOC1.
What is the InChIKey of (1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(oxan-3-yl)methanone?
The InChIKey is HDQTXYSCWVXPKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO2/c1-2-16-15-8-4-3-6-13(15)9-10-18(16)17(19)14-7-5-11-20-12-14/h3-4,6,8,14,16H,2,5,7,9-12H2,1H3.
What are the key properties of (1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(oxan-3-yl)methanone?
(1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(oxan-3-yl)methanone has a molecular weight of 273.38 g/mol, XLogP of 2.95, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethyl-3,4-dihydro-1H-isoquinolin-2-yl)-(oxan-3-yl)methanone is sourced from PubChem (CID 71931183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).