C15H28F3IN4 — CID 71931267
2-(2-methylpropyl)-1-prop-2-enyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide (PubChem CID 71931267) has the molecular formula C15H28F3IN4 and a molecular weight of 448.32 g/mol. Its IUPAC name is 2-(2-methylpropyl)-1-prop-2-enyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-(2-methylpropyl)-1-prop-2-enyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 71931267 |
| Molecular Formula | C15H28F3IN4 |
| Molecular Weight | 448.32 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 2-(2-methylpropyl)-1-prop-2-enyl-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
| SMILES | C=CCN/C(=N\CC(C)C)NCC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C15H27F3N4.HI/c1-4-6-19-14(20-8-12(2)3)21-9-13-5-7-22(10-13)11-15(16,17)18;/h4,12-13H,1,5-11H2,2-3H3,(H2,19,20,21);1H |
| InChIKey | ZPYRTTKRDBYWQV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|