C11H23NO3S — CID 71931421
N-(1-ethylsulfonylpropan-2-yl)-2,2-dimethylbutanamide (PubChem CID 71931421) has the molecular formula C11H23NO3S and a molecular weight of 249.38 g/mol. Its IUPAC name is N-(1-ethylsulfonylpropan-2-yl)-2,2-dimethylbutanamide.
| Compound Name | N-(1-ethylsulfonylpropan-2-yl)-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 71931421 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | N-(1-ethylsulfonylpropan-2-yl)-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)NC(C)CS(=O)(=O)CC |
| InChI | InChI=1S/C11H23NO3S/c1-6-11(4,5)10(13)12-9(3)8-16(14,15)7-2/h9H,6-8H2,1-5H3,(H,12,13) |
| InChIKey | PWEDFGYCQYJHQF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |