C17H27N3O2S — CID 71931677
3-[3-(cyclopropylmethoxy)propyl]-1-methyl-1-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl)urea (PubChem CID 71931677) has the molecular formula C17H27N3O2S and a molecular weight of 337.49 g/mol. Its IUPAC name is 3-[3-(cyclopropylmethoxy)propyl]-1-methyl-1-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl)urea.
| Compound Name | 3-[3-(cyclopropylmethoxy)propyl]-1-methyl-1-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl)urea |
|---|---|
| PubChem CID | 71931677 |
| Molecular Formula | C17H27N3O2S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 3-[3-(cyclopropylmethoxy)propyl]-1-methyl-1-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl)urea |
| SMILES | Cc1nc2c(s1)C(N(C)C(=O)NCCCOCC1CC1)CCC2 |
| InChI | InChI=1S/C17H27N3O2S/c1-12-19-14-5-3-6-15(16(14)23-12)20(2)17(21)18-9-4-10-22-11-13-7-8-13/h13,15H,3-11H2,1-2H3,(H,18,21) |
| InChIKey | GGBWTVFWRIVNJD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|