About 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[2-(trifluoromethyl)cyclohexyl]urea
1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[2-(trifluoromethyl)cyclohexyl]urea (PubChem CID 71932031) has the molecular formula C14H21F3N4O
and a molecular weight of 318.34 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[2-(trifluoromethyl)cyclohexyl]urea.
Molecular Properties
| Compound Name | 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[2-(trifluoromethyl)cyclohexyl]urea |
| PubChem CID | 71932031 |
| Molecular Formula | C14H21F3N4O |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[2-(trifluoromethyl)cyclohexyl]urea |
| SMILES | Cc1n[nH]c(C)c1CNC(=O)NC1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C14H21F3N4O/c1-8-10(9(2)21-20-8)7-18-13(22)19-12-6-4-3-5-11(12)14(15,16)17/h11-12H,3-7H2,1-2H3,(H,20,21)(H2,18,19,22) |
| InChIKey | MXBTVXHJNCTMSX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[2-(trifluoromethyl)cyclohexyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[2-(trifluoromethyl)cyclohexyl]urea?
The IUPAC name of 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[2-(trifluoromethyl)cyclohexyl]urea (CID 71932031) is 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[2-(trifluoromethyl)cyclohexyl]urea.
What is the SMILES notation for 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[2-(trifluoromethyl)cyclohexyl]urea?
The canonical SMILES for 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[2-(trifluoromethyl)cyclohexyl]urea is Cc1n[nH]c(C)c1CNC(=O)NC1CCCCC1C(F)(F)F.
What is the InChIKey of 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[2-(trifluoromethyl)cyclohexyl]urea?
The InChIKey is MXBTVXHJNCTMSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21F3N4O/c1-8-10(9(2)21-20-8)7-18-13(22)19-12-6-4-3-5-11(12)14(15,16)17/h11-12H,3-7H2,1-2H3,(H,20,21)(H2,18,19,22).
What are the key properties of 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[2-(trifluoromethyl)cyclohexyl]urea?
1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[2-(trifluoromethyl)cyclohexyl]urea has a molecular weight of 318.34 g/mol, XLogP of 2.95, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-[2-(trifluoromethyl)cyclohexyl]urea is sourced from PubChem (CID 71932031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).