About 2-(furan-3-yl)-N,N-dimethyl-1,3-thiazole-4-carboxamide
2-(furan-3-yl)-N,N-dimethyl-1,3-thiazole-4-carboxamide (PubChem CID 71932201) has the molecular formula C10H10N2O2S
and a molecular weight of 222.27 g/mol. Its IUPAC name is 2-(furan-3-yl)-N,N-dimethyl-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(furan-3-yl)-N,N-dimethyl-1,3-thiazole-4-carboxamide |
| PubChem CID | 71932201 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 2-(furan-3-yl)-N,N-dimethyl-1,3-thiazole-4-carboxamide |
| SMILES | CN(C)C(=O)c1csc(-c2ccoc2)n1 |
| InChI | InChI=1S/C10H10N2O2S/c1-12(2)10(13)8-6-15-9(11-8)7-3-4-14-5-7/h3-6H,1-2H3 |
| InChIKey | GHHIQGPTYSSNPF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(furan-3-yl)-N,N-dimethyl-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(furan-3-yl)-N,N-dimethyl-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-(furan-3-yl)-N,N-dimethyl-1,3-thiazole-4-carboxamide (CID 71932201) is 2-(furan-3-yl)-N,N-dimethyl-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-(furan-3-yl)-N,N-dimethyl-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-(furan-3-yl)-N,N-dimethyl-1,3-thiazole-4-carboxamide is CN(C)C(=O)c1csc(-c2ccoc2)n1.
What is the InChIKey of 2-(furan-3-yl)-N,N-dimethyl-1,3-thiazole-4-carboxamide?
The InChIKey is GHHIQGPTYSSNPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2S/c1-12(2)10(13)8-6-15-9(11-8)7-3-4-14-5-7/h3-6H,1-2H3.
What are the key properties of 2-(furan-3-yl)-N,N-dimethyl-1,3-thiazole-4-carboxamide?
2-(furan-3-yl)-N,N-dimethyl-1,3-thiazole-4-carboxamide has a molecular weight of 222.27 g/mol, XLogP of 2.10, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furan-3-yl)-N,N-dimethyl-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 71932201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).