C25H31N5O2 — CID 71932804
N-[1-(2-methoxyphenyl)ethyl]-2-[4-[(1-phenylpyrazol-4-yl)methyl]piperazin-1-yl]acetamide (PubChem CID 71932804) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is N-[1-(2-methoxyphenyl)ethyl]-2-[4-[(1-phenylpyrazol-4-yl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-[1-(2-methoxyphenyl)ethyl]-2-[4-[(1-phenylpyrazol-4-yl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 71932804 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | N-[1-(2-methoxyphenyl)ethyl]-2-[4-[(1-phenylpyrazol-4-yl)methyl]piperazin-1-yl]acetamide |
| SMILES | COc1ccccc1C(C)NC(=O)CN1CCN(Cc2cnn(-c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C25H31N5O2/c1-20(23-10-6-7-11-24(23)32-2)27-25(31)19-29-14-12-28(13-15-29)17-21-16-26-30(18-21)22-8-4-3-5-9-22/h3-11,16,18,20H,12-15,17,19H2,1-2H3,(H,27,31) |
| InChIKey | KMZVURWAQQAEKT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |