C15H22N6 — CID 71932904
N-[(5-methylpyrazin-2-yl)methyl]-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 71932904) has the molecular formula C15H22N6 and a molecular weight of 286.38 g/mol. Its IUPAC name is N-[(5-methylpyrazin-2-yl)methyl]-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | N-[(5-methylpyrazin-2-yl)methyl]-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 71932904 |
| Molecular Formula | C15H22N6 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | N-[(5-methylpyrazin-2-yl)methyl]-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | Cc1cnc(CNC2CCc3nc(C(C)C)nn3C2)cn1 |
| InChI | InChI=1S/C15H22N6/c1-10(2)15-19-14-5-4-12(9-21(14)20-15)18-8-13-7-16-11(3)6-17-13/h6-7,10,12,18H,4-5,8-9H2,1-3H3 |
| InChIKey | PPNLWFUALMPBOP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |